C19H24F2N4O — CID 144710189
(2Z)-4,5-diamino-3-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]penta-2,4-dien-2-ol (PubChem CID 144710189) has the molecular formula C19H24F2N4O and a molecular weight of 362.42 g/mol. Its IUPAC name is (2Z)-4,5-diamino-3-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]penta-2,4-dien-2-ol.
| Compound Name | (2Z)-4,5-diamino-3-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 144710189 |
| Molecular Formula | C19H24F2N4O |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2Z)-4,5-diamino-3-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]penta-2,4-dien-2-ol |
| SMILES | C/C(O)=C(/C(N)=CN)c1cnc2ccn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C19H24F2N4O/c1-12(26)18(15(23)9-22)14-8-17-16(24-10-14)4-7-25(17)11-13-2-5-19(20,21)6-3-13/h4,7-10,13,26H,2-3,5-6,11,22-23H2,1H3/b15-9?,18-12- |
| InChIKey | IYSPYGAQODZCTB-NJGUCXQBSA-N |
| XLogP | 3.91 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|