C26H33F2N5 — CID 144710125
(Z)-1-[1-[(4,4-difluorocyclohexyl)methyl]-3-(4-ethylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-2-hydrazinyl-N-methylprop-1-en-1-amine (PubChem CID 144710125) has the molecular formula C26H33F2N5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (Z)-1-[1-[(4,4-difluorocyclohexyl)methyl]-3-(4-ethylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-2-hydrazinyl-N-methylprop-1-en-1-amine.
| Compound Name | (Z)-1-[1-[(4,4-difluorocyclohexyl)methyl]-3-(4-ethylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-2-hydrazinyl-N-methylprop-1-en-1-amine |
|---|---|
| PubChem CID | 144710125 |
| Molecular Formula | C26H33F2N5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (Z)-1-[1-[(4,4-difluorocyclohexyl)methyl]-3-(4-ethylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-2-hydrazinyl-N-methylprop-1-en-1-amine |
| SMILES | CCc1ccc(-c2cn(CC3CCC(F)(F)CC3)c3cc(/C(NC)=C(\C)NN)cnc23)cc1 |
| InChI | InChI=1S/C26H33F2N5/c1-4-18-5-7-20(8-6-18)22-16-33(15-19-9-11-26(27,28)12-10-19)23-13-21(14-31-25(22)23)24(30-3)17(2)32-29/h5-8,13-14,16,19,30,32H,4,9-12,15,29H2,1-3H3/b24-17- |
| InChIKey | YTUVFNQWIDLBJZ-ULJHMMPZSA-N |
| XLogP | 5.46 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|