C27H25F2N3O3 — CID 118059594
4-[1-[(4,4-difluorocyclohexyl)methyl]-6-(1-methyl-6-oxo-3-pyridinyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid (PubChem CID 118059594) has the molecular formula C27H25F2N3O3 and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-[1-[(4,4-difluorocyclohexyl)methyl]-6-(1-methyl-6-oxo-3-pyridinyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid.
| Compound Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-6-(1-methyl-6-oxo-3-pyridinyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 118059594 |
| Molecular Formula | C27H25F2N3O3 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-6-(1-methyl-6-oxo-3-pyridinyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
| SMILES | Cn1cc(-c2cnc3c(-c4ccc(C(=O)O)cc4)cn(CC4CCC(F)(F)CC4)c3c2)ccc1=O |
| InChI | InChI=1S/C27H25F2N3O3/c1-31-15-20(6-7-24(31)33)21-12-23-25(30-13-21)22(18-2-4-19(5-3-18)26(34)35)16-32(23)14-17-8-10-27(28,29)11-9-17/h2-7,12-13,15-17H,8-11,14H2,1H3,(H,34,35) |
| InChIKey | ZIQUJRDJVOKMAG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|