C21H22F2N4O — CID 118059761
5-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-N-methylpyridine-2-carboxamide (PubChem CID 118059761) has the molecular formula C21H22F2N4O and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 118059761 |
| Molecular Formula | C21H22F2N4O |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-[1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-6-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cnc3ccn(CC4CCC(F)(F)CC4)c3c2)cn1 |
| InChI | InChI=1S/C21H22F2N4O/c1-24-20(28)18-3-2-15(11-26-18)16-10-19-17(25-12-16)6-9-27(19)13-14-4-7-21(22,23)8-5-14/h2-3,6,9-12,14H,4-5,7-8,13H2,1H3,(H,24,28) |
| InChIKey | QVSSRVXFDKGKSU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|