About 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene
9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene (PubChem CID 143561149) has the molecular formula C30H31N
and a molecular weight of 405.59 g/mol. Its IUPAC name is 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene.
Molecular Properties
| Compound Name | 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene |
| PubChem CID | 143561149 |
| Molecular Formula | C30H31N |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene |
| SMILES | CCc1ccc(C)c(-c2ccccc2C)c1.CCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C16H18.C14H13N/c1-4-14-10-9-13(3)16(11-14)15-8-6-5-7-12(15)2;1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h5-11H,4H2,1-3H3;3-10H,2H2,1H3 |
| InChIKey | DCMQOEGPEQOFCK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene?
The IUPAC name of 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene (CID 143561149) is 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene.
What is the SMILES notation for 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene?
The canonical SMILES for 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene is CCc1ccc(C)c(-c2ccccc2C)c1.CCn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene?
The InChIKey is DCMQOEGPEQOFCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.C14H13N/c1-4-14-10-9-13(3)16(11-14)15-8-6-5-7-12(15)2;1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h5-11H,4H2,1-3H3;3-10H,2H2,1H3.
What are the key properties of 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene?
9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene has a molecular weight of 405.59 g/mol, XLogP of 8.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylcarbazole;4-ethyl-1-methyl-2-(2-methylphenyl)benzene is sourced from PubChem (CID 143561149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).