About 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene
3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene (PubChem CID 162241948) has the molecular formula C34H35N3
and a molecular weight of 485.68 g/mol. Its IUPAC name is 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene.
Molecular Properties
| Compound Name | 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene |
| PubChem CID | 162241948 |
| Molecular Formula | C34H35N3 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene |
| SMILES | CCC1=NN=C(CC)C1.CCn1c2ccccc2c2ccccc21.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H13N.C13H10.C7H12N2/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-6-5-7(4-2)9-8-6/h3-10H,2H2,1H3;1-8H,9H2;3-5H2,1-2H3 |
| InChIKey | ZWUZIZJVSXTAQV-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene?
The IUPAC name of 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene (CID 162241948) is 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene.
What is the SMILES notation for 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene?
The canonical SMILES for 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene is CCC1=NN=C(CC)C1.CCn1c2ccccc2c2ccccc21.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene?
The InChIKey is ZWUZIZJVSXTAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N.C13H10.C7H12N2/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-6-5-7(4-2)9-8-6/h3-10H,2H2,1H3;1-8H,9H2;3-5H2,1-2H3.
What are the key properties of 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene?
3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene has a molecular weight of 485.68 g/mol, XLogP of 9.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-4H-pyrazole;9-ethylcarbazole;9H-fluorene is sourced from PubChem (CID 162241948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).