C26H35F3N6O4S — CID 143561706
N'-amino-N-methyl-N-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]methanimidamide;N-[(4-propan-2-ylphenyl)methyl]formamide (PubChem CID 143561706) has the molecular formula C26H35F3N6O4S and a molecular weight of 584.67 g/mol. Its IUPAC name is N'-amino-N-methyl-N-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]methanimidamide;N-[(4-propan-2-ylphenyl)methyl]formamide.
| Compound Name | N'-amino-N-methyl-N-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]methanimidamide;N-[(4-propan-2-ylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 143561706 |
| Molecular Formula | C26H35F3N6O4S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | N'-amino-N-methyl-N-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]methanimidamide;N-[(4-propan-2-ylphenyl)methyl]formamide |
| SMILES | CC(C)c1ccc(CNC=O)cc1.CN(/C=N\N)CC(=O)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F3N5O3S.C11H15NO/c1-21(11-20-19)10-14(24)22-6-8-23(9-7-22)27(25,26)13-4-2-12(3-5-13)15(16,17)18;1-9(2)11-5-3-10(4-6-11)7-12-8-13/h2-5,11H,6-10,19H2,1H3;3-6,8-9H,7H2,1-2H3,(H,12,13)/b20-11-; |
| InChIKey | MVBHIWIXUMAMPQ-FZLYBSHOSA-N |
| XLogP | 2.43 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|