C30H36F3N5O5S — CID 89217099
methyl (2E)-2-[[[amino-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methylidene]amino]methylidene]-3-methylbut-3-enoate (PubChem CID 89217099) has the molecular formula C30H36F3N5O5S and a molecular weight of 635.71 g/mol. Its IUPAC name is methyl (2E)-2-[[[amino-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methylidene]amino]methylidene]-3-methylbut-3-enoate.
| Compound Name | methyl (2E)-2-[[[amino-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methylidene]amino]methylidene]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 89217099 |
| Molecular Formula | C30H36F3N5O5S |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | methyl (2E)-2-[[[amino-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methylidene]amino]methylidene]-3-methylbut-3-enoate |
| SMILES | C=C(C)/C(=C\N=C(/N)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)[C@@H](C(=O)NCc2ccc(C(C)C)cc2)C1)C(=O)OC |
| InChI | InChI=1S/C30H36F3N5O5S/c1-19(2)22-8-6-21(7-9-22)16-35-27(39)26-18-37(29(34)36-17-25(20(3)4)28(40)43-5)14-15-38(26)44(41,42)24-12-10-23(11-13-24)30(31,32)33/h6-13,17,19,26H,3,14-16,18H2,1-2,4-5H3,(H2,34,36)(H,35,39)/b25-17+/t26-/m1/s1 |
| InChIKey | MFCXYSAMLOMFGI-SIYKBWGXSA-N |
| XLogP | 3.77 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|