C25H35N3O5S — CID 143561775
1-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]ethanone;N-[(4-propan-2-ylphenyl)methyl]formamide (PubChem CID 143561775) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]ethanone;N-[(4-propan-2-ylphenyl)methyl]formamide.
| Compound Name | 1-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]ethanone;N-[(4-propan-2-ylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 143561775 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)sulfonyl-3-methylpiperazin-1-yl]ethanone;N-[(4-propan-2-ylphenyl)methyl]formamide |
| SMILES | CC(C)c1ccc(CNC=O)cc1.COc1ccc(S(=O)(=O)N2CCN(C(C)=O)CC2C)cc1 |
| InChI | InChI=1S/C14H20N2O4S.C11H15NO/c1-11-10-15(12(2)17)8-9-16(11)21(18,19)14-6-4-13(20-3)5-7-14;1-9(2)11-5-3-10(4-6-11)7-12-8-13/h4-7,11H,8-10H2,1-3H3;3-6,8-9H,7H2,1-2H3,(H,12,13) |
| InChIKey | HRDFRVOSBPYQFT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|