C12H20O7 — CID 143562159
[(2R,4R,6R)-6-acetyloxy-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate (PubChem CID 143562159) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is [(2R,4R,6R)-6-acetyloxy-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,4R,6R)-6-acetyloxy-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 143562159 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(2R,4R,6R)-6-acetyloxy-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](OC(C)O)C[C@@H](OC(C)=O)O1 |
| InChI | InChI=1S/C12H20O7/c1-7(13)16-6-11-4-10(17-8(2)14)5-12(19-11)18-9(3)15/h8,10-12,14H,4-6H2,1-3H3/t8?,10-,11-,12+/m1/s1 |
| InChIKey | VMYCYHQRXLGKPJ-AGZJKDLHSA-N |
| XLogP | 0.34 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|