C11H14F3NS — CID 143563885
methyl (2E,4E)-N-ethyl-5-(trifluoromethyl)hepta-2,4,6-trienimidothioate (PubChem CID 143563885) has the molecular formula C11H14F3NS and a molecular weight of 249.30 g/mol. Its IUPAC name is methyl (2E,4E)-N-ethyl-5-(trifluoromethyl)hepta-2,4,6-trienimidothioate.
| Compound Name | methyl (2E,4E)-N-ethyl-5-(trifluoromethyl)hepta-2,4,6-trienimidothioate |
|---|---|
| PubChem CID | 143563885 |
| Molecular Formula | C11H14F3NS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl (2E,4E)-N-ethyl-5-(trifluoromethyl)hepta-2,4,6-trienimidothioate |
| SMILES | C=C/C(=C\C=C\C(=N\CC)SC)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NS/c1-4-9(11(12,13)14)7-6-8-10(16-3)15-5-2/h4,6-8H,1,5H2,2-3H3/b8-6+,9-7+,15-10- |
| InChIKey | NNOSJKDUBAXQNX-SWYYXVGYSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|