C14H18F3NS — CID 91235729
(7,7,7-trifluoro-3-prop-1-enylhepta-1,3,5-trien-2-yl) N-ethylethanimidothioate (PubChem CID 91235729) has the molecular formula C14H18F3NS and a molecular weight of 289.37 g/mol. Its IUPAC name is (7,7,7-trifluoro-3-prop-1-enylhepta-1,3,5-trien-2-yl) N-ethylethanimidothioate.
| Compound Name | (7,7,7-trifluoro-3-prop-1-enylhepta-1,3,5-trien-2-yl) N-ethylethanimidothioate |
|---|---|
| PubChem CID | 91235729 |
| Molecular Formula | C14H18F3NS |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (7,7,7-trifluoro-3-prop-1-enylhepta-1,3,5-trien-2-yl) N-ethylethanimidothioate |
| SMILES | C=C(S/C(C)=N/CC)C(C=CC)=CC=CC(F)(F)F |
| InChI | InChI=1S/C14H18F3NS/c1-5-8-13(9-7-10-14(15,16)17)11(3)19-12(4)18-6-2/h5,7-10H,3,6H2,1-2,4H3/b8-5?,10-7?,13-9?,18-12+ |
| InChIKey | CKNTUEDNBUULAA-LWDCVRPJSA-N |
| XLogP | 5.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|