C8H14N2O — CID 143564797
N-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]acetamide (PubChem CID 143564797) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]acetamide.
| Compound Name | N-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 143564797 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]acetamide |
| SMILES | C=C/C(=C\N(C)C)NC(C)=O |
| InChI | InChI=1S/C8H14N2O/c1-5-8(6-10(3)4)9-7(2)11/h5-6H,1H2,2-4H3,(H,9,11)/b8-6+ |
| InChIKey | RDZAUHBMIALQHS-SOFGYWHQSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|