C16H15Cl2FN2O — CID 143568149
4-[5-(3,5-dichloro-4-methylphenyl)-6-fluoro-2-pyridinyl]morpholine (PubChem CID 143568149) has the molecular formula C16H15Cl2FN2O and a molecular weight of 341.21 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-methylphenyl)-6-fluoro-2-pyridinyl]morpholine.
| Compound Name | 4-[5-(3,5-dichloro-4-methylphenyl)-6-fluoro-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 143568149 |
| Molecular Formula | C16H15Cl2FN2O |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-methylphenyl)-6-fluoro-2-pyridinyl]morpholine |
| SMILES | Cc1c(Cl)cc(-c2ccc(N3CCOCC3)nc2F)cc1Cl |
| InChI | InChI=1S/C16H15Cl2FN2O/c1-10-13(17)8-11(9-14(10)18)12-2-3-15(20-16(12)19)21-4-6-22-7-5-21/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | RSNDVLCBLJFGDL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|