C19H25N5O2 — CID 168929038
5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methylpyridin-3-amine (PubChem CID 168929038) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methylpyridin-3-amine.
| Compound Name | 5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methylpyridin-3-amine |
|---|---|
| PubChem CID | 168929038 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methylpyridin-3-amine |
| SMILES | Cc1ncc(N)cc1-c1cc(N2CCOCC2)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C19H25N5O2/c1-14-17(12-16(20)13-21-14)15-10-18(23-2-6-25-7-3-23)22-19(11-15)24-4-8-26-9-5-24/h10-13H,2-9,20H2,1H3 |
| InChIKey | HMQDHJAVJVTKRG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |