C28H33F2N5O3 — CID 134379493
(2E)-2-[(E)-3,3-difluoro-2-methylprop-1-enyl]-N-[5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methyl-3-pyridinyl]penta-2,4-dienamide (PubChem CID 134379493) has the molecular formula C28H33F2N5O3 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2E)-2-[(E)-3,3-difluoro-2-methylprop-1-enyl]-N-[5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methyl-3-pyridinyl]penta-2,4-dienamide.
| Compound Name | (2E)-2-[(E)-3,3-difluoro-2-methylprop-1-enyl]-N-[5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methyl-3-pyridinyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 134379493 |
| Molecular Formula | C28H33F2N5O3 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (2E)-2-[(E)-3,3-difluoro-2-methylprop-1-enyl]-N-[5-(2,6-dimorpholin-4-yl-4-pyridinyl)-6-methyl-3-pyridinyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C(/C)C(F)F)C(=O)Nc1cnc(C)c(-c2cc(N3CCOCC3)nc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C28H33F2N5O3/c1-4-5-21(14-19(2)27(29)30)28(36)32-23-17-24(20(3)31-18-23)22-15-25(34-6-10-37-11-7-34)33-26(16-22)35-8-12-38-13-9-35/h4-5,14-18,27H,1,6-13H2,2-3H3,(H,32,36)/b19-14+,21-5+ |
| InChIKey | KXXLBGKXDRGXGZ-LDEYLQGGSA-N |
| XLogP | 4.39 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|