C27H30FN5O2 — CID 139435426
(E,2E)-N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-5-fluoro-4,5-dimethyl-2-[(methylideneamino)methylidene]hex-3-enamide (PubChem CID 139435426) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is (E,2E)-N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-5-fluoro-4,5-dimethyl-2-[(methylideneamino)methylidene]hex-3-enamide.
| Compound Name | (E,2E)-N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-5-fluoro-4,5-dimethyl-2-[(methylideneamino)methylidene]hex-3-enamide |
|---|---|
| PubChem CID | 139435426 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (E,2E)-N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-5-fluoro-4,5-dimethyl-2-[(methylideneamino)methylidene]hex-3-enamide |
| SMILES | C=N/C=C(\C=C(/C)C(C)(C)F)C(=O)Nc1ccc(C)c(-c2cnc(N3CCOCC3)c(C#N)c2)c1 |
| InChI | InChI=1S/C27H30FN5O2/c1-18-6-7-23(32-26(34)22(16-30-5)12-19(2)27(3,4)28)14-24(18)21-13-20(15-29)25(31-17-21)33-8-10-35-11-9-33/h6-7,12-14,16-17H,5,8-11H2,1-4H3,(H,32,34)/b19-12+,22-16+ |
| InChIKey | KOXGIQUQTNOIHB-HXGVYNGWSA-N |
| XLogP | 4.98 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|