C26H30N8O — CID 155216219
(Z,2E)-4-amino-2-(aminomethylidene)-5-cyano-N-[3-(5-cyano-6-piperazin-1-yl-3-pyridinyl)-4-methylphenyl]-5-methylhex-3-enamide (PubChem CID 155216219) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-5-cyano-N-[3-(5-cyano-6-piperazin-1-yl-3-pyridinyl)-4-methylphenyl]-5-methylhex-3-enamide.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-5-cyano-N-[3-(5-cyano-6-piperazin-1-yl-3-pyridinyl)-4-methylphenyl]-5-methylhex-3-enamide |
|---|---|
| PubChem CID | 155216219 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-5-cyano-N-[3-(5-cyano-6-piperazin-1-yl-3-pyridinyl)-4-methylphenyl]-5-methylhex-3-enamide |
| SMILES | Cc1ccc(NC(=O)C(/C=C(\N)C(C)(C)C#N)=C/N)cc1-c1cnc(N2CCNCC2)c(C#N)c1 |
| InChI | InChI=1S/C26H30N8O/c1-17-4-5-21(33-25(35)19(14-28)11-23(30)26(2,3)16-29)12-22(17)20-10-18(13-27)24(32-15-20)34-8-6-31-7-9-34/h4-5,10-12,14-15,31H,6-9,28,30H2,1-3H3,(H,33,35)/b19-14+,23-11- |
| InChIKey | JOBBQCGFVUSIBC-SAXOWWPNSA-N |
| XLogP | 2.51 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|