C25H27F3N4O3 — CID 145333088
(Z,2E)-4-amino-2-(aminomethylidene)-5,5,5-trifluoro-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]pent-3-enamide (PubChem CID 145333088) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-5,5,5-trifluoro-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]pent-3-enamide.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-5,5,5-trifluoro-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]pent-3-enamide |
|---|---|
| PubChem CID | 145333088 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-5,5,5-trifluoro-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]pent-3-enamide |
| SMILES | Cc1ccc(NC(=O)C(/C=C(\N)C(F)(F)F)=C/N)cc1-c1ccc2c(c1)N1CCOCC1CC2O |
| InChI | InChI=1S/C25H27F3N4O3/c1-14-2-4-17(31-24(34)16(12-29)9-23(30)25(26,27)28)10-20(14)15-3-5-19-21(8-15)32-6-7-35-13-18(32)11-22(19)33/h2-5,8-10,12,18,22,33H,6-7,11,13,29-30H2,1H3,(H,31,34)/b16-12+,23-9- |
| InChIKey | LPDRIKHFTKSEKN-SYWWYUPTSA-N |
| XLogP | 3.49 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|