C23H22F3N5O — CID 139435435
(Z,2E)-N-[3-[5-cyano-6-(dimethylamino)-3-pyridinyl]-4-methylphenyl]-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enamide (PubChem CID 139435435) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is (Z,2E)-N-[3-[5-cyano-6-(dimethylamino)-3-pyridinyl]-4-methylphenyl]-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enamide.
| Compound Name | (Z,2E)-N-[3-[5-cyano-6-(dimethylamino)-3-pyridinyl]-4-methylphenyl]-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enamide |
|---|---|
| PubChem CID | 139435435 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (Z,2E)-N-[3-[5-cyano-6-(dimethylamino)-3-pyridinyl]-4-methylphenyl]-2-ethylidene-5,5,5-trifluoro-4-(methylideneamino)pent-3-enamide |
| SMILES | C=N/C(=C\C(=C/C)C(=O)Nc1ccc(C)c(-c2cnc(N(C)C)c(C#N)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C23H22F3N5O/c1-6-15(10-20(28-3)23(24,25)26)22(32)30-18-8-7-14(2)19(11-18)17-9-16(12-27)21(29-13-17)31(4)5/h6-11,13H,3H2,1-2,4-5H3,(H,30,32)/b15-6+,20-10- |
| InChIKey | DOJPMRJQTLKFLN-URVJRWLZSA-N |
| XLogP | 5.03 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|