C27H36N6O2 — CID 130178662
(Z,2E)-N-[3-[2-(dimethylamino)-6-morpholin-4-ylpyrimidin-4-yl]-4-methylphenyl]-2-ethylidene-5-methyl-4-(methylideneamino)hex-3-enamide (PubChem CID 130178662) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is (Z,2E)-N-[3-[2-(dimethylamino)-6-morpholin-4-ylpyrimidin-4-yl]-4-methylphenyl]-2-ethylidene-5-methyl-4-(methylideneamino)hex-3-enamide.
| Compound Name | (Z,2E)-N-[3-[2-(dimethylamino)-6-morpholin-4-ylpyrimidin-4-yl]-4-methylphenyl]-2-ethylidene-5-methyl-4-(methylideneamino)hex-3-enamide |
|---|---|
| PubChem CID | 130178662 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | (Z,2E)-N-[3-[2-(dimethylamino)-6-morpholin-4-ylpyrimidin-4-yl]-4-methylphenyl]-2-ethylidene-5-methyl-4-(methylideneamino)hex-3-enamide |
| SMILES | C=N/C(=C\C(=C/C)C(=O)Nc1ccc(C)c(-c2cc(N3CCOCC3)nc(N(C)C)n2)c1)C(C)C |
| InChI | InChI=1S/C27H36N6O2/c1-8-20(15-23(28-5)18(2)3)26(34)29-21-10-9-19(4)22(16-21)24-17-25(31-27(30-24)32(6)7)33-11-13-35-14-12-33/h8-10,15-18H,5,11-14H2,1-4,6-7H3,(H,29,34)/b20-8+,23-15- |
| InChIKey | GFMSPCIYTOKUFE-QJFYEECESA-N |
| XLogP | 4.48 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|