C25H38N6O3 — CID 168929179
1-[4-[5-(3,3-dimethylbutylamino)-2-methylphenyl]-6-morpholin-4-ylpyrimidin-2-yl]azetidin-3-ol;formamide (PubChem CID 168929179) has the molecular formula C25H38N6O3 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-[4-[5-(3,3-dimethylbutylamino)-2-methylphenyl]-6-morpholin-4-ylpyrimidin-2-yl]azetidin-3-ol;formamide.
| Compound Name | 1-[4-[5-(3,3-dimethylbutylamino)-2-methylphenyl]-6-morpholin-4-ylpyrimidin-2-yl]azetidin-3-ol;formamide |
|---|---|
| PubChem CID | 168929179 |
| Molecular Formula | C25H38N6O3 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 1-[4-[5-(3,3-dimethylbutylamino)-2-methylphenyl]-6-morpholin-4-ylpyrimidin-2-yl]azetidin-3-ol;formamide |
| SMILES | Cc1ccc(NCCC(C)(C)C)cc1-c1cc(N2CCOCC2)nc(N2CC(O)C2)n1.NC=O |
| InChI | InChI=1S/C24H35N5O2.CH3NO/c1-17-5-6-18(25-8-7-24(2,3)4)13-20(17)21-14-22(28-9-11-31-12-10-28)27-23(26-21)29-15-19(30)16-29;2-1-3/h5-6,13-14,19,25,30H,7-12,15-16H2,1-4H3;1H,(H2,2,3) |
| InChIKey | FEQVHQMQEBIYHJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|