C28H34N4O4 — CID 168928447
2-[[4-[5-(2,3-dihydro-1H-inden-1-ylamino)-2-methylphenyl]-6-morpholin-4-yl-2-pyridinyl]oxy]ethanol;formamide (PubChem CID 168928447) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[[4-[5-(2,3-dihydro-1H-inden-1-ylamino)-2-methylphenyl]-6-morpholin-4-yl-2-pyridinyl]oxy]ethanol;formamide.
| Compound Name | 2-[[4-[5-(2,3-dihydro-1H-inden-1-ylamino)-2-methylphenyl]-6-morpholin-4-yl-2-pyridinyl]oxy]ethanol;formamide |
|---|---|
| PubChem CID | 168928447 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[[4-[5-(2,3-dihydro-1H-inden-1-ylamino)-2-methylphenyl]-6-morpholin-4-yl-2-pyridinyl]oxy]ethanol;formamide |
| SMILES | Cc1ccc(NC2CCc3ccccc32)cc1-c1cc(OCCO)nc(N2CCOCC2)c1.NC=O |
| InChI | InChI=1S/C27H31N3O3.CH3NO/c1-19-6-8-22(28-25-9-7-20-4-2-3-5-23(20)25)18-24(19)21-16-26(30-10-13-32-14-11-30)29-27(17-21)33-15-12-31;2-1-3/h2-6,8,16-18,25,28,31H,7,9-15H2,1H3;1H,(H2,2,3) |
| InChIKey | QXKZDMYKHXCZPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|