C31H35N3O7 — CID 164758575
N-[4-methyl-3-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 164758575) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is N-[4-methyl-3-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-methyl-3-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 164758575 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | N-[4-methyl-3-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1-c1cc(OCCOC2CCCCO2)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C31H35N3O7/c1-21-5-7-24(32-31(35)22-6-8-26-27(16-22)41-20-40-26)19-25(21)23-17-28(34-9-12-36-13-10-34)33-29(18-23)37-14-15-39-30-4-2-3-11-38-30/h5-8,16-19,30H,2-4,9-15,20H2,1H3,(H,32,35) |
| InChIKey | VEPWPTYKRNJVQF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|