C30H34F6N4O5 — CID 155253739
N-[2-fluoro-4-methyl-5-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-3-(1,1,2,2,2-pentafluoroethyl)-2,5-dihydropyrrole-1-carboxamide (PubChem CID 155253739) has the molecular formula C30H34F6N4O5 and a molecular weight of 644.61 g/mol. Its IUPAC name is N-[2-fluoro-4-methyl-5-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-3-(1,1,2,2,2-pentafluoroethyl)-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | N-[2-fluoro-4-methyl-5-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-3-(1,1,2,2,2-pentafluoroethyl)-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 155253739 |
| Molecular Formula | C30H34F6N4O5 |
| Molecular Weight | 644.61 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | N-[2-fluoro-4-methyl-5-[2-morpholin-4-yl-6-[2-(oxan-2-yloxy)ethoxy]-4-pyridinyl]phenyl]-3-(1,1,2,2,2-pentafluoroethyl)-2,5-dihydropyrrole-1-carboxamide |
| SMILES | Cc1cc(F)c(NC(=O)N2CC=C(C(F)(F)C(F)(F)F)C2)cc1-c1cc(OCCOC2CCCCO2)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C30H34F6N4O5/c1-19-14-23(31)24(37-28(41)40-6-5-21(18-40)29(32,33)30(34,35)36)17-22(19)20-15-25(39-7-10-42-11-8-39)38-26(16-20)43-12-13-45-27-4-2-3-9-44-27/h5,14-17,27H,2-4,6-13,18H2,1H3,(H,37,41) |
| InChIKey | WYGXXXJBRFGAQG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|