C27H33F2N5O3 — CID 138714222
(Z,2E)-2-ethylidene-5,5-difluoro-N-[3-[2-(2-hydroxyethylamino)-6-morpholin-4-yl-4-pyridinyl]-4-methylphenyl]-4-(methylideneamino)hex-3-enamide (PubChem CID 138714222) has the molecular formula C27H33F2N5O3 and a molecular weight of 513.59 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5,5-difluoro-N-[3-[2-(2-hydroxyethylamino)-6-morpholin-4-yl-4-pyridinyl]-4-methylphenyl]-4-(methylideneamino)hex-3-enamide.
| Compound Name | (Z,2E)-2-ethylidene-5,5-difluoro-N-[3-[2-(2-hydroxyethylamino)-6-morpholin-4-yl-4-pyridinyl]-4-methylphenyl]-4-(methylideneamino)hex-3-enamide |
|---|---|
| PubChem CID | 138714222 |
| Molecular Formula | C27H33F2N5O3 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (Z,2E)-2-ethylidene-5,5-difluoro-N-[3-[2-(2-hydroxyethylamino)-6-morpholin-4-yl-4-pyridinyl]-4-methylphenyl]-4-(methylideneamino)hex-3-enamide |
| SMILES | C=N/C(=C\C(=C/C)C(=O)Nc1ccc(C)c(-c2cc(NCCO)nc(N3CCOCC3)c2)c1)C(C)(F)F |
| InChI | InChI=1S/C27H33F2N5O3/c1-5-19(14-23(30-4)27(3,28)29)26(36)32-21-7-6-18(2)22(17-21)20-15-24(31-8-11-35)33-25(16-20)34-9-12-37-13-10-34/h5-7,14-17,35H,4,8-13H2,1-3H3,(H,31,33)(H,32,36)/b19-5+,23-14- |
| InChIKey | PJSDAGYGZYUQPL-LGOWWHFASA-N |
| XLogP | 4.42 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|