C25H24N4O4S — CID 130405118
N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-2-methylsulfonylbenzamide (PubChem CID 130405118) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 130405118 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[3-(5-cyano-6-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-2-methylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2S(C)(=O)=O)cc1-c1cnc(N2CCOCC2)c(C#N)c1 |
| InChI | InChI=1S/C25H24N4O4S/c1-17-7-8-20(28-25(30)21-5-3-4-6-23(21)34(2,31)32)14-22(17)19-13-18(15-26)24(27-16-19)29-9-11-33-12-10-29/h3-8,13-14,16H,9-12H2,1-2H3,(H,28,30) |
| InChIKey | SCFAIGZSGPYQFI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |