About 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine
1-tert-butyl-2-methoxy-3,3-dimethylpiperidine (PubChem CID 14356860) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine |
| PubChem CID | 14356860 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine |
| SMILES | COC1N(C(C)(C)C)CCCC1(C)C |
| InChI | InChI=1S/C12H25NO/c1-11(2,3)13-9-7-8-12(4,5)10(13)14-6/h10H,7-9H2,1-6H3 |
| InChIKey | RDENRSBJZJLFJF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine?
The IUPAC name of 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine (CID 14356860) is 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine.
What is the SMILES notation for 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine?
The canonical SMILES for 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine is COC1N(C(C)(C)C)CCCC1(C)C.
What is the InChIKey of 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine?
The InChIKey is RDENRSBJZJLFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-11(2,3)13-9-7-8-12(4,5)10(13)14-6/h10H,7-9H2,1-6H3.
What are the key properties of 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine?
1-tert-butyl-2-methoxy-3,3-dimethylpiperidine has a molecular weight of 199.34 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-methoxy-3,3-dimethylpiperidine is sourced from PubChem (CID 14356860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).