C16H31N — CID 176747897
1,2-ditert-butyl-2-azaspiro[4.4]nonane (PubChem CID 176747897) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 1,2-ditert-butyl-2-azaspiro[4.4]nonane.
| Compound Name | 1,2-ditert-butyl-2-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 176747897 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 1,2-ditert-butyl-2-azaspiro[4.4]nonane |
| SMILES | CC(C)(C)C1N(C(C)(C)C)CCC12CCCC2 |
| InChI | InChI=1S/C16H31N/c1-14(2,3)13-16(9-7-8-10-16)11-12-17(13)15(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | VGBOIXVPYCIOEI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |