C17H34N2 — CID 172515504
7,8-ditert-butyl-2-methyl-2,8-diazaspiro[4.5]decane (PubChem CID 172515504) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 7,8-ditert-butyl-2-methyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 7,8-ditert-butyl-2-methyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 172515504 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 7,8-ditert-butyl-2-methyl-2,8-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CCN(C(C)(C)C)C(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C17H34N2/c1-15(2,3)14-12-17(8-10-18(7)13-17)9-11-19(14)16(4,5)6/h14H,8-13H2,1-7H3 |
| InChIKey | YDEBXUVIMGHHSJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |