C13H26N2 — CID 126627824
(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine (PubChem CID 126627824) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine.
| Compound Name | (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine |
|---|---|
| PubChem CID | 126627824 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine |
| SMILES | CC(C)(C)C1N(C(C)(C)C)C[C@@H]2C[C@]12N |
| InChI | InChI=1S/C13H26N2/c1-11(2,3)10-13(14)7-9(13)8-15(10)12(4,5)6/h9-10H,7-8,14H2,1-6H3/t9-,10?,13+/m0/s1 |
| InChIKey | DOJXQMPPHGWUID-BOURZNODSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |