About (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine
(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine (PubChem CID 126627824) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine.
Molecular Properties
| Compound Name | (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine |
| PubChem CID | 126627824 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine |
| SMILES | CC(C)(C)C1N(C(C)(C)C)C[C@@H]2C[C@]12N |
| InChI | InChI=1S/C13H26N2/c1-11(2,3)10-13(14)7-9(13)8-15(10)12(4,5)6/h9-10H,7-8,14H2,1-6H3/t9-,10?,13+/m0/s1 |
| InChIKey | DOJXQMPPHGWUID-BOURZNODSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine?
The IUPAC name of (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine (CID 126627824) is (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine.
What is the SMILES notation for (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine?
The canonical SMILES for (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine is CC(C)(C)C1N(C(C)(C)C)C[C@@H]2C[C@]12N.
What is the InChIKey of (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine?
The InChIKey is DOJXQMPPHGWUID-BOURZNODSA-N. The full InChI is InChI=1S/C13H26N2/c1-11(2,3)10-13(14)7-9(13)8-15(10)12(4,5)6/h9-10H,7-8,14H2,1-6H3/t9-,10?,13+/m0/s1.
What are the key properties of (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine?
(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine has a molecular weight of 210.36 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexan-1-amine is sourced from PubChem (CID 126627824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).