C20H13ClN2O5S — CID 143568709
5-[[6-[(1Z,3E)-4-chloro-1-sulfanylbuta-1,3-dienyl]-3-cyano-4-(furan-3-yl)-2-pyridinyl]oxymethyl]furan-2-carboxylic acid (PubChem CID 143568709) has the molecular formula C20H13ClN2O5S and a molecular weight of 428.85 g/mol. Its IUPAC name is 5-[[6-[(1Z,3E)-4-chloro-1-sulfanylbuta-1,3-dienyl]-3-cyano-4-(furan-3-yl)-2-pyridinyl]oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[[6-[(1Z,3E)-4-chloro-1-sulfanylbuta-1,3-dienyl]-3-cyano-4-(furan-3-yl)-2-pyridinyl]oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 143568709 |
| Molecular Formula | C20H13ClN2O5S |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 5-[[6-[(1Z,3E)-4-chloro-1-sulfanylbuta-1,3-dienyl]-3-cyano-4-(furan-3-yl)-2-pyridinyl]oxymethyl]furan-2-carboxylic acid |
| SMILES | N#Cc1c(-c2ccoc2)cc(/C(S)=C/C=C/Cl)nc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C20H13ClN2O5S/c21-6-1-2-18(29)16-8-14(12-5-7-26-10-12)15(9-22)19(23-16)27-11-13-3-4-17(28-13)20(24)25/h1-8,10,29H,11H2,(H,24,25)/b6-1+,18-2- |
| InChIKey | RIYDOGXUAJORRF-UULWRSLESA-N |
| XLogP | 5.11 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|