C23H19N3O3S — CID 143568690
methyl 4-[[[3-cyano-4-(furan-3-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]amino]methyl]benzoate (PubChem CID 143568690) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 4-[[[3-cyano-4-(furan-3-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[3-cyano-4-(furan-3-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 143568690 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | methyl 4-[[[3-cyano-4-(furan-3-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-pyridinyl]amino]methyl]benzoate |
| SMILES | C=C/C=C(\S)c1cc(-c2ccoc2)c(C#N)c(NCc2ccc(C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C23H19N3O3S/c1-3-4-21(30)20-11-18(17-9-10-29-14-17)19(12-24)22(26-20)25-13-15-5-7-16(8-6-15)23(27)28-2/h3-11,14,30H,1,13H2,2H3,(H,25,26)/b21-4- |
| InChIKey | NALMYBFCDUDJDL-IGLQUIOVSA-N |
| XLogP | 5.07 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|