C15H14N4O2 — CID 71173554
methyl 4-[[(5-cyano-2-methylpyrimidin-4-yl)amino]methyl]benzoate (PubChem CID 71173554) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 4-[[(5-cyano-2-methylpyrimidin-4-yl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(5-cyano-2-methylpyrimidin-4-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 71173554 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl 4-[[(5-cyano-2-methylpyrimidin-4-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2nc(C)ncc2C#N)cc1 |
| InChI | InChI=1S/C15H14N4O2/c1-10-17-9-13(7-16)14(19-10)18-8-11-3-5-12(6-4-11)15(20)21-2/h3-6,9H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | SNGSFYSWZMJGEO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |