C22H14N3NaO3S — CID 169428089
sodium 4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]benzoate (PubChem CID 169428089) has the molecular formula C22H14N3NaO3S and a molecular weight of 423.43 g/mol. Its IUPAC name is sodium 4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]benzoate.
| Compound Name | sodium 4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 169428089 |
| Molecular Formula | C22H14N3NaO3S |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | sodium 4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]benzoate |
| SMILES | N#Cc1c(-c2ccoc2)cc(-c2cccs2)nc1NCc1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C22H15N3O3S.Na/c23-11-18-17(16-7-8-28-13-16)10-19(20-2-1-9-29-20)25-21(18)24-12-14-3-5-15(6-4-14)22(26)27;/h1-10,13H,12H2,(H,24,25)(H,26,27);/q;+1/p-1 |
| InChIKey | WFUVNJDOMBAQGB-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |