C23H18N2O4S — CID 143568629
4-[[4-(furan-3-yl)-3-[(methylideneamino)methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid (PubChem CID 143568629) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is 4-[[4-(furan-3-yl)-3-[(methylideneamino)methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid.
| Compound Name | 4-[[4-(furan-3-yl)-3-[(methylideneamino)methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 143568629 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[[4-(furan-3-yl)-3-[(methylideneamino)methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
| SMILES | C=NCc1c(-c2ccoc2)cc(-c2cccs2)nc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H18N2O4S/c1-24-12-19-18(17-8-9-28-14-17)11-20(21-3-2-10-30-21)25-22(19)29-13-15-4-6-16(7-5-15)23(26)27/h2-11,14H,1,12-13H2,(H,26,27) |
| InChIKey | VZSTYBPFYDFKHK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|