C22H15BrN2O4S — CID 143568618
3-bromo-4-[[4-(furan-3-yl)-3-methanimidoyl-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid (PubChem CID 143568618) has the molecular formula C22H15BrN2O4S and a molecular weight of 483.34 g/mol. Its IUPAC name is 3-bromo-4-[[4-(furan-3-yl)-3-methanimidoyl-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid.
| Compound Name | 3-bromo-4-[[4-(furan-3-yl)-3-methanimidoyl-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 143568618 |
| Molecular Formula | C22H15BrN2O4S |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 3-bromo-4-[[4-(furan-3-yl)-3-methanimidoyl-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
| SMILES | [H]/N=C/c1c(-c2ccoc2)cc(-c2cccs2)nc1OCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C22H15BrN2O4S/c23-18-8-13(22(26)27)3-4-15(18)12-29-21-17(10-24)16(14-5-6-28-11-14)9-19(25-21)20-2-1-7-30-20/h1-11,24H,12H2,(H,26,27)/b24-10+ |
| InChIKey | SWNKATJRJQODPE-YSURURNPSA-N |
| XLogP | 6.11 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|