C22H19NO4S — CID 143568701
4-[[4-[[(1Z)-buta-1,3-dienoxy]methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid (PubChem CID 143568701) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-[[4-[[(1Z)-buta-1,3-dienoxy]methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid.
| Compound Name | 4-[[4-[[(1Z)-buta-1,3-dienoxy]methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 143568701 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-[[4-[[(1Z)-buta-1,3-dienoxy]methyl]-6-thiophen-2-yl-2-pyridinyl]oxymethyl]benzoic acid |
| SMILES | C=C/C=C\OCc1cc(OCc2ccc(C(=O)O)cc2)nc(-c2cccs2)c1 |
| InChI | InChI=1S/C22H19NO4S/c1-2-3-10-26-14-17-12-19(20-5-4-11-28-20)23-21(13-17)27-15-16-6-8-18(9-7-16)22(24)25/h2-13H,1,14-15H2,(H,24,25)/b10-3- |
| InChIKey | ZRUPKFCZXSBRAU-KMKOMSMNSA-N |
| XLogP | 5.30 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|