C17H12N2O3S — CID 118528210
3-[(3E)-hexa-1,3,5-trien-3-yl]-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (PubChem CID 118528210) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid.
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 118528210 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| SMILES | C=C/C=C(\C=C)c1noc2nc(-c3cccs3)cc(C(=O)O)c12 |
| InChI | InChI=1S/C17H12N2O3S/c1-3-6-10(4-2)15-14-11(17(20)21)9-12(13-7-5-8-23-13)18-16(14)22-19-15/h3-9H,1-2H2,(H,20,21)/b10-6+ |
| InChIKey | ZFWYDAXRNLUQTI-UXBLZVDNSA-N |
| XLogP | 4.40 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|