C20H14FN3O2S — CID 171315490
3-(4-fluorophenyl)-N-prop-2-enyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 171315490) has the molecular formula C20H14FN3O2S and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-prop-2-enyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-prop-2-enyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171315490 |
| Molecular Formula | C20H14FN3O2S |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-prop-2-enyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(-c2cccs2)nc2onc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C20H14FN3O2S/c1-2-9-22-19(25)14-11-15(16-4-3-10-27-16)23-20-17(14)18(24-26-20)12-5-7-13(21)8-6-12/h2-8,10-11H,1,9H2,(H,22,25) |
| InChIKey | FZOQWKWEGSYASP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|