C22H18FN3O3 — CID 44824377
3-(4-fluorophenyl)-N-(2-methoxyethyl)-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 44824377) has the molecular formula C22H18FN3O3 and a molecular weight of 391.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2-methoxyethyl)-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(2-methoxyethyl)-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44824377 |
| Molecular Formula | C22H18FN3O3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2-methoxyethyl)-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccccc2)nc2onc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C22H18FN3O3/c1-28-12-11-24-21(27)17-13-18(14-5-3-2-4-6-14)25-22-19(17)20(26-29-22)15-7-9-16(23)10-8-15/h2-10,13H,11-12H2,1H3,(H,24,27) |
| InChIKey | RDPASALGNAEPJK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|