C22H20N7OS+ — CID 143568688
(Z)-[amino-[4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]phenyl]methylidene]-hydrazinylazanium (PubChem CID 143568688) has the molecular formula C22H20N7OS+ and a molecular weight of 430.52 g/mol. Its IUPAC name is (Z)-[amino-[4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]phenyl]methylidene]-hydrazinylazanium.
| Compound Name | (Z)-[amino-[4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]phenyl]methylidene]-hydrazinylazanium |
|---|---|
| PubChem CID | 143568688 |
| Molecular Formula | C22H20N7OS+ |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (Z)-[amino-[4-[[[3-cyano-4-(furan-3-yl)-6-thiophen-2-yl-2-pyridinyl]amino]methyl]phenyl]methylidene]-hydrazinylazanium |
| SMILES | N#Cc1c(-c2ccoc2)cc(-c2cccs2)nc1NCc1ccc(/C(N)=[NH+]/NN)cc1 |
| InChI | InChI=1S/C22H19N7OS/c23-11-18-17(16-7-8-30-13-16)10-19(20-2-1-9-31-20)27-22(18)26-12-14-3-5-15(6-4-14)21(24)28-29-25/h1-10,13,29H,12,25H2,(H2,24,28)(H,26,27)/p+1 |
| InChIKey | FKBAADIBEDTYEQ-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|