C29H29ClN8O2 — CID 143569409
2-[4-[2-[[2-[4-(2-aminoethylamino)-8-methylquinazolin-2-yl]phenoxy]amino]ethylamino]pyrimidin-2-yl]-4-chlorophenol (PubChem CID 143569409) has the molecular formula C29H29ClN8O2 and a molecular weight of 557.06 g/mol. Its IUPAC name is 2-[4-[2-[[2-[4-(2-aminoethylamino)-8-methylquinazolin-2-yl]phenoxy]amino]ethylamino]pyrimidin-2-yl]-4-chlorophenol.
| Compound Name | 2-[4-[2-[[2-[4-(2-aminoethylamino)-8-methylquinazolin-2-yl]phenoxy]amino]ethylamino]pyrimidin-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 143569409 |
| Molecular Formula | C29H29ClN8O2 |
| Molecular Weight | 557.06 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 2-[4-[2-[[2-[4-(2-aminoethylamino)-8-methylquinazolin-2-yl]phenoxy]amino]ethylamino]pyrimidin-2-yl]-4-chlorophenol |
| SMILES | Cc1cccc2c(NCCN)nc(-c3ccccc3ONCCNc3ccnc(-c4cc(Cl)ccc4O)n3)nc12 |
| InChI | InChI=1S/C29H29ClN8O2/c1-18-5-4-7-21-26(18)37-29(38-27(21)34-14-12-31)20-6-2-3-8-24(20)40-35-16-15-32-25-11-13-33-28(36-25)22-17-19(30)9-10-23(22)39/h2-11,13,17,35,39H,12,14-16,31H2,1H3,(H,32,33,36)(H,34,37,38) |
| InChIKey | NKATZIMEEHOJEG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.06 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|