C17H24F3NO2 — CID 143569533
ethane;methyl 2-[2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate (PubChem CID 143569533) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is ethane;methyl 2-[2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate.
| Compound Name | ethane;methyl 2-[2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 143569533 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethane;methyl 2-[2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
| SMILES | CC.COC(=O)CC1CCNC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H18F3NO2.C2H6/c1-21-14(20)9-10-6-7-19-13(8-10)11-2-4-12(5-3-11)15(16,17)18;1-2/h2-5,10,13,19H,6-9H2,1H3;1-2H3 |
| InChIKey | AEVACIXWOXLAMV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |