C28H40F3NO2 — CID 59201204
methyl 2-[(2S,4R)-1-[(5S)-2,2,8,8-tetramethylnon-3-yn-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate (PubChem CID 59201204) has the molecular formula C28H40F3NO2 and a molecular weight of 479.63 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-1-[(5S)-2,2,8,8-tetramethylnon-3-yn-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[(2S,4R)-1-[(5S)-2,2,8,8-tetramethylnon-3-yn-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 59201204 |
| Molecular Formula | C28H40F3NO2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | methyl 2-[(2S,4R)-1-[(5S)-2,2,8,8-tetramethylnon-3-yn-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CCN([C@H](C#CC(C)(C)C)CCC(C)(C)C)[C@H](c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C28H40F3NO2/c1-26(2,3)15-12-23(13-16-27(4,5)6)32-17-14-20(19-25(33)34-7)18-24(32)21-8-10-22(11-9-21)28(29,30)31/h8-11,20,23-24H,12,14-15,17-19H2,1-7H3/t20-,23+,24+/m1/s1 |
| InChIKey | HQHACZGQXHLNLJ-QDSKXPNFSA-N |
| XLogP | 7.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|