C26H34F3NO2 — CID 162542841
methyl 2-[(2S,4R)-1-(2,8-dimethylnon-1-en-3-yn-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate (PubChem CID 162542841) has the molecular formula C26H34F3NO2 and a molecular weight of 449.56 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-1-(2,8-dimethylnon-1-en-3-yn-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[(2S,4R)-1-(2,8-dimethylnon-1-en-3-yn-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 162542841 |
| Molecular Formula | C26H34F3NO2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | methyl 2-[(2S,4R)-1-(2,8-dimethylnon-1-en-3-yn-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]acetate |
| SMILES | C=C(C)C#CC(CCC(C)C)N1CC[C@@H](CC(=O)OC)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H34F3NO2/c1-18(2)6-12-23(13-7-19(3)4)30-15-14-20(17-25(31)32-5)16-24(30)21-8-10-22(11-9-21)26(27,28)29/h8-11,19-20,23-24H,1,7,13-17H2,2-5H3/t20-,23?,24+/m1/s1 |
| InChIKey | MZVYDAPAYPRPCH-MCGLMZNDSA-N |
| XLogP | 6.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|