C24H28F6NO2- — CID 154337333
2-[(2S,3R)-1-[(4S)-1,1,1-trifluoro-7,7-dimethyloct-5-yn-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetate (PubChem CID 154337333) has the molecular formula C24H28F6NO2- and a molecular weight of 476.48 g/mol. Its IUPAC name is 2-[(2S,3R)-1-[(4S)-1,1,1-trifluoro-7,7-dimethyloct-5-yn-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetate.
| Compound Name | 2-[(2S,3R)-1-[(4S)-1,1,1-trifluoro-7,7-dimethyloct-5-yn-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 154337333 |
| Molecular Formula | C24H28F6NO2- |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[(2S,3R)-1-[(4S)-1,1,1-trifluoro-7,7-dimethyloct-5-yn-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetate |
| SMILES | CC(C)(C)C#C[C@H](CCC(F)(F)F)N1CCC[C@H](CC(=O)[O-])C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H29F6NO2/c1-22(2,3)12-10-19(11-13-23(25,26)27)31-14-4-5-17(15-20(32)33)21(31)16-6-8-18(9-7-16)24(28,29)30/h6-9,17,19,21H,4-5,11,13-15H2,1-3H3,(H,32,33)/p-1/t17-,19-,21?/m1/s1 |
| InChIKey | XOMQXNZPFGQEES-ONTUJTEPSA-M |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|