C20H36ClNO — CID 143571262
3-(4-chlorophenyl)-N-heptan-3-ylpropanamide;ethane (PubChem CID 143571262) has the molecular formula C20H36ClNO and a molecular weight of 341.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-heptan-3-ylpropanamide;ethane.
| Compound Name | 3-(4-chlorophenyl)-N-heptan-3-ylpropanamide;ethane |
|---|---|
| PubChem CID | 143571262 |
| Molecular Formula | C20H36ClNO |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 3-(4-chlorophenyl)-N-heptan-3-ylpropanamide;ethane |
| SMILES | CC.CC.CCCCC(CC)NC(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO.2C2H6/c1-3-5-6-15(4-2)18-16(19)12-9-13-7-10-14(17)11-8-13;2*1-2/h7-8,10-11,15H,3-6,9,12H2,1-2H3,(H,18,19);2*1-2H3 |
| InChIKey | AZWVSSTTWDAXJT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |