C18H30N2 — CID 143571372
2,3-diethyl-1-[(1E,3Z)-3-(ethylideneamino)hexa-1,3,5-trienyl]cyclohexan-1-amine (PubChem CID 143571372) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2,3-diethyl-1-[(1E,3Z)-3-(ethylideneamino)hexa-1,3,5-trienyl]cyclohexan-1-amine.
| Compound Name | 2,3-diethyl-1-[(1E,3Z)-3-(ethylideneamino)hexa-1,3,5-trienyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 143571372 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 2,3-diethyl-1-[(1E,3Z)-3-(ethylideneamino)hexa-1,3,5-trienyl]cyclohexan-1-amine |
| SMILES | C=C/C=C(/C=C/C1(N)CCCC(CC)C1CC)\N=C\C |
| InChI | InChI=1S/C18H30N2/c1-5-10-16(20-8-4)12-14-18(19)13-9-11-15(6-2)17(18)7-3/h5,8,10,12,14-15,17H,1,6-7,9,11,13,19H2,2-4H3/b14-12+,16-10-,20-8+ |
| InChIKey | VDAOLAQDAITLTR-RBBNHTMFSA-N |
| XLogP | 4.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|