C16H28N2 — CID 143682311
4-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-en-3-yl]cyclohexan-1-amine (PubChem CID 143682311) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-en-3-yl]cyclohexan-1-amine.
| Compound Name | 4-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-en-3-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 143682311 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 4-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-en-3-yl]cyclohexan-1-amine |
| SMILES | C=C(C(=C/C)/N=C/C)C(CC)C1CCC(N)CC1 |
| InChI | InChI=1S/C16H28N2/c1-5-15(12(4)16(6-2)18-7-3)13-8-10-14(17)11-9-13/h6-7,13-15H,4-5,8-11,17H2,1-3H3/b16-6-,18-7+ |
| InChIKey | QUFUFQYQKCERHE-FAKNLOEVSA-N |
| XLogP | 4.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|